CAS 67882-97-7 appears in our catalog under these names: 4-[2-(Pyridin-4-yl)ethenyl]phenol, 98%, 4–(2–(pyridin–4–yl)ethenyl)phenol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 10g, 250mg, 1g, 50mg.
4-[(E)-2-pyridin-4-ylethenyl]phenol (CAS 67882-97-7) is a chemical compound with the molecular formula C13H11NO and a molecular weight of 197.23 g/mol. IUPAC name: 4-[(E)-2-pyridin-4-ylethenyl]phenol. InChIKey: NZSWYXAQUBELKN-OWOJBTEDSA-N.
| Molecular formula | C13H11NO |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | 4-[(E)-2-pyridin-4-ylethenyl]phenol |
| InChIKey | NZSWYXAQUBELKN-OWOJBTEDSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC=NC=C2)O |
Computed by PubChem (NCBI)