CAS 67899-41-6 appears in our catalog under these names: Perfluoro(allylbenzene), 95%, 3–(Pentafluorophenyl)pentafluoro–1–propene, 3-(Pentafluorophenyl)pentafluoro-1-propene, >98.0%(GC). Offered by: Combi-blocks, GLPBio, TCI. Available pack sizes: 5g, 100g, 25g, 1g.
1,2,3,4,5-pentafluoro-6-(1,1,2,3,3-pentafluoroprop-2-enyl)benzene (CAS 67899-41-6) is a chemical compound with the molecular formula C9F10 and a molecular weight of 298.08 g/mol. IUPAC name: 1,2,3,4,5-pentafluoro-6-(1,1,2,3,3-pentafluoroprop-2-enyl)benzene. InChIKey: WRHBYJDZKRNITP-UHFFFAOYSA-N.
| Molecular formula | C9F10 |
|---|---|
| Molecular weight | 298.08 g/mol |
| IUPAC name | 1,2,3,4,5-pentafluoro-6-(1,1,2,3,3-pentafluoroprop-2-enyl)benzene |
| InChIKey | WRHBYJDZKRNITP-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)C(C(=C(F)F)F)(F)F |
Computed by PubChem (NCBI)