Products 6790-63-2
CAS 6790-63-2 is the registry number for Aplysin. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
(3S,3aS,8bS)-7-bromo-3,3a,6,8b-tetramethyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran (CAS 6790-63-2) is a chemical compound with the molecular formula C15H19BrO and a molecular weight of 295.21 g/mol. IUPAC name: (3S,3aS,8bS)-7-bromo-3,3a,6,8b-tetramethyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran. InChIKey: AZMIIVUEOLBHBL-LKTVYLICSA-N.
| Molecular formula | C15H19BrO |
|---|---|
| Molecular weight | 295.21 g/mol |
| IUPAC name | (3S,3aS,8bS)-7-bromo-3,3a,6,8b-tetramethyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran |
| InChIKey | AZMIIVUEOLBHBL-LKTVYLICSA-N |
| SMILES | C[C@H]1CC[C@@]2([C@]1(OC3=C2C=C(C(=C3)C)Br)C)C |
Computed by PubChem (NCBI)