CAS 67903-52-0 is the registry number for Bromopride N-Oxide. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4-amino-5-bromo-2-methoxybenzoyl)amino]-N,N-diethylethanamine oxide (CAS 67903-52-0) is a chemical compound with the molecular formula C14H22BrN3O3 and a molecular weight of 360.25 g/mol. IUPAC name: 2-[(4-amino-5-bromo-2-methoxybenzoyl)amino]-N,N-diethylethanamine oxide. InChIKey: PLZPCOSSINNXIO-UHFFFAOYSA-N.
| Molecular formula | C14H22BrN3O3 |
|---|---|
| Molecular weight | 360.25 g/mol |
| IUPAC name | 2-[(4-amino-5-bromo-2-methoxybenzoyl)amino]-N,N-diethylethanamine oxide |
| InChIKey | PLZPCOSSINNXIO-UHFFFAOYSA-N |
| SMILES | CC[N+](CC)(CCNC(=O)C1=CC(=C(C=C1OC)N)Br)[O-] |
Computed by PubChem (NCBI)