Products 67903-52-0

CAS 67903-52-0 is the registry number for Bromopride N-Oxide. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(4-amino-5-bromo-2-methoxybenzoyl)amino]-N,N-diethylethanamine oxide (CAS 67903-52-0) is a chemical compound with the molecular formula C14H22BrN3O3 and a molecular weight of 360.25 g/mol. IUPAC name: 2-[(4-amino-5-bromo-2-methoxybenzoyl)amino]-N,N-diethylethanamine oxide. InChIKey: PLZPCOSSINNXIO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H22BrN3O3
Molecular weight360.25 g/mol
IUPAC name2-[(4-amino-5-bromo-2-methoxybenzoyl)amino]-N,N-diethylethanamine oxide
InChIKeyPLZPCOSSINNXIO-UHFFFAOYSA-N
SMILESCC[N+](CC)(CCNC(=O)C1=CC(=C(C=C1OC)N)Br)[O-]

Computed by PubChem (NCBI)