CAS 67909-31-3 is the registry number for 4-Methyl-7-trimethylsilyloxycoumarin. Offered by: TRC. Available pack sizes: 1g, 2g, 5g.
4-methyl-7-trimethylsilyloxychromen-2-one (CAS 67909-31-3) is a chemical compound with the molecular formula C13H16O3Si and a molecular weight of 248.35 g/mol. IUPAC name: 4-methyl-7-trimethylsilyloxychromen-2-one. InChIKey: QHQOZLBDGGWMFA-UHFFFAOYSA-N.
| Molecular formula | C13H16O3Si |
|---|---|
| Molecular weight | 248.35 g/mol |
| IUPAC name | 4-methyl-7-trimethylsilyloxychromen-2-one |
| InChIKey | QHQOZLBDGGWMFA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)O[Si](C)(C)C |
Computed by PubChem (NCBI)