CAS 6792-31-0 appears in our catalog under these names: Hexafluoropropene trimer 97%, HEXAFLUOROPROPENE, TRIMER, Hexafluoropropene trimer, 97%. Offered by: Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 50g, 100g.
1,1,2,3,3,3-hexafluoroprop-1-ene (CAS 6792-31-0) is a chemical compound with the molecular formula C9F18 and a molecular weight of 450.07 g/mol. IUPAC name: 1,1,2,3,3,3-hexafluoroprop-1-ene. InChIKey: VJRSWIKVCUMTFK-UHFFFAOYSA-N.
| Molecular formula | C9F18 |
|---|---|
| Molecular weight | 450.07 g/mol |
| IUPAC name | 1,1,2,3,3,3-hexafluoroprop-1-ene |
| InChIKey | VJRSWIKVCUMTFK-UHFFFAOYSA-N |
| SMILES | C(=C(F)F)(C(F)(F)F)F.C(=C(F)F)(C(F)(F)F)F.C(=C(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)