CAS 67922-27-4 is the registry number for 1,2,3,4,5,7-Hexachloronaphthalene. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3,4,5,7-hexachloronaphthalene (CAS 67922-27-4) is a chemical compound with the molecular formula C10H2Cl6 and a molecular weight of 334.8 g/mol. IUPAC name: 1,2,3,4,5,7-hexachloronaphthalene. InChIKey: SWRNUKWDDYPZGV-UHFFFAOYSA-N.
| Molecular formula | C10H2Cl6 |
|---|---|
| Molecular weight | 334.8 g/mol |
| IUPAC name | 1,2,3,4,5,7-hexachloronaphthalene |
| InChIKey | SWRNUKWDDYPZGV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=C(C(=C2Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)