CAS 679413-92-4 is the registry number for methyl 4-(5-bromothiophene-2-sulfonamido)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 4-[(5-bromothiophen-2-yl)sulfonylamino]benzoate (CAS 679413-92-4) is a chemical compound with the molecular formula C12H10BrNO4S2 and a molecular weight of 376.3 g/mol. IUPAC name: methyl 4-[(5-bromothiophen-2-yl)sulfonylamino]benzoate. InChIKey: LDBRNPORLIZBIF-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO4S2 |
|---|---|
| Molecular weight | 376.3 g/mol |
| IUPAC name | methyl 4-[(5-bromothiophen-2-yl)sulfonylamino]benzoate |
| InChIKey | LDBRNPORLIZBIF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(S2)Br |
Computed by PubChem (NCBI)