Products 679433-09-1

CAS 679433-09-1 is the registry number for 3-Hydroxyazetidine-1-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-hydroxyazetidine-1-sulfonyl chloride (CAS 679433-09-1) is a chemical compound with the molecular formula C3H6ClNO3S and a molecular weight of 171.60 g/mol. IUPAC name: 3-hydroxyazetidine-1-sulfonyl chloride. InChIKey: SAHVOCUPULMDBO-UHFFFAOYSA-N.

Identity
Molecular formulaC3H6ClNO3S
Molecular weight171.60 g/mol
IUPAC name3-hydroxyazetidine-1-sulfonyl chloride
InChIKeySAHVOCUPULMDBO-UHFFFAOYSA-N
SMILESC1C(CN1S(=O)(=O)Cl)O

Computed by PubChem (NCBI)