CAS 67944-25-6 is the registry number for Prazosin Hydrochloride Dihydrate, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 500mg.
[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(furan-2-yl)methanone;hydrochloride (CAS 67944-25-6) is a chemical compound with the molecular formula C19H22ClN5O4 and a molecular weight of 419.9 g/mol. IUPAC name: [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(furan-2-yl)methanone;hydrochloride. InChIKey: WFXFYZULCQKPIP-UHFFFAOYSA-N.
| Molecular formula | C19H22ClN5O4 |
|---|---|
| Molecular weight | 419.9 g/mol |
| IUPAC name | [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(furan-2-yl)methanone;hydrochloride |
| InChIKey | WFXFYZULCQKPIP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC(=N2)N3CCN(CC3)C(=O)C4=CC=CO4)N)OC.Cl |
Computed by PubChem (NCBI)