CAS 67950-05-4 appears in our catalog under these names: Bis(2,4,6-trimethylphenyl)phosphorus chloride, 95%, BIS(2,4,6-TRIMETHYLPHENYL)PHOSPHORUS CH&. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 1g.
Chloro-bis(2,4,6-trimethylphenyl)phosphane (CAS 67950-05-4) is a chemical compound with the molecular formula C18H22ClP and a molecular weight of 304.8 g/mol. IUPAC name: chloro-bis(2,4,6-trimethylphenyl)phosphane. InChIKey: AZIJQQZQDFCANM-UHFFFAOYSA-N.
| Molecular formula | C18H22ClP |
|---|---|
| Molecular weight | 304.8 g/mol |
| IUPAC name | chloro-bis(2,4,6-trimethylphenyl)phosphane |
| InChIKey | AZIJQQZQDFCANM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)P(C2=C(C=C(C=C2C)C)C)Cl)C |
Computed by PubChem (NCBI)