CAS 679787-08-7 appears in our catalog under these names: 5-Bromo-PAPS, 5–Bromo–PAPS, 5-Bromo-PAPS, ≥95%, ≥95%. Offered by: TRC, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 500mg, 25mg, 100MG, 5mg.
Disodium;3-[4-[(5-bromo-2-pyridinyl)diazenyl]-3-oxido-N-propylanilino]propane-1-sulfonate (CAS 679787-08-7) is a chemical compound with the molecular formula C17H19BrN4Na2O4S and a molecular weight of 501.3 g/mol. IUPAC name: disodium;3-[4-[(5-bromo-2-pyridinyl)diazenyl]-3-oxido-N-propylanilino]propane-1-sulfonate. InChIKey: AZQQDIOTZJGZJL-UHFFFAOYSA-L.
| Molecular formula | C17H19BrN4Na2O4S |
|---|---|
| Molecular weight | 501.3 g/mol |
| IUPAC name | disodium;3-[4-[(5-bromo-2-pyridinyl)diazenyl]-3-oxido-N-propylanilino]propane-1-sulfonate |
| InChIKey | AZQQDIOTZJGZJL-UHFFFAOYSA-L |
| SMILES | CCCN(CCCS(=O)(=O)[O-])C1=CC(=C(C=C1)N=NC2=NC=C(C=C2)Br)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)