CAS 67989-88-2 appears in our catalog under these names: Ethylenediaminetetraacetic acid diammonium copper salt, 75% in H2O, Ethylenediaminetetraacetic acid diammonium copper salt solution, Ammonium ((ethylenedinitrilo)tetraacetato)cuprate(II), ETHYLENEDIAMINETETRAACETIC ACID DIAMMONI, ETHYLENEDIAMINETETRAACETIC ACID COPPER &. Offered by: Chemat Brand, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 250ml, 50ml, 0,5l, 1L.
Azanium;copper;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate (CAS 67989-88-2) is a chemical compound with the molecular formula C10H16CuN3O8- and a molecular weight of 369.80 g/mol. IUPAC name: azanium;copper;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate. InChIKey: CMHPCPKGHHIRER-UHFFFAOYSA-K.
| Molecular formula | C10H16CuN3O8- |
|---|---|
| Molecular weight | 369.80 g/mol |
| IUPAC name | azanium;copper;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate |
| InChIKey | CMHPCPKGHHIRER-UHFFFAOYSA-K |
| SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[NH4+].[Cu+2] |
Computed by PubChem (NCBI)