CAS 67999-53-5 appears in our catalog under these names: Rac-(1r,2s,4r)-bicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 95%, (1R,2S,4R)-Bicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 95%, (1R,2S,4R)-Bicyclo(2.2.1)hept-5-ene-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
(1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (CAS 67999-53-5) is a chemical compound with the molecular formula C8H10O2 and a molecular weight of 138.16 g/mol. IUPAC name: (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylic acid. InChIKey: FYGUSUBEMUKACF-VQVTYTSYSA-N.
| Molecular formula | C8H10O2 |
|---|---|
| Molecular weight | 138.16 g/mol |
| IUPAC name | (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| InChIKey | FYGUSUBEMUKACF-VQVTYTSYSA-N |
| SMILES | C1[C@@H]2C[C@@H]([C@H]1C=C2)C(=O)O |
Computed by PubChem (NCBI)