CAS 680214-07-7 is the registry number for N1-(1-Acetyl-2,3-dihydro-1h-indol-5-yl)-4-chloro-3-nitrobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 50mg.
N-(1-acetyl-2,3-dihydroindol-5-yl)-4-chloro-3-nitrobenzamide (CAS 680214-07-7) is a chemical compound with the molecular formula C17H14ClN3O4 and a molecular weight of 359.8 g/mol. IUPAC name: N-(1-acetyl-2,3-dihydroindol-5-yl)-4-chloro-3-nitrobenzamide. InChIKey: YSEYKADRONCAOZ-UHFFFAOYSA-N.
| Molecular formula | C17H14ClN3O4 |
|---|---|
| Molecular weight | 359.8 g/mol |
| IUPAC name | N-(1-acetyl-2,3-dihydroindol-5-yl)-4-chloro-3-nitrobenzamide |
| InChIKey | YSEYKADRONCAOZ-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C1C=CC(=C2)NC(=O)C3=CC(=C(C=C3)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)