CAS 680216-40-4 is the registry number for 4-hydrazino-5,6-dimethyl-2-(trifluoromethyl)pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[5,6-dimethyl-2-(trifluoromethyl)pyrimidin-4-yl]hydrazine (CAS 680216-40-4) is a chemical compound with the molecular formula C7H9F3N4 and a molecular weight of 206.17 g/mol. IUPAC name: [5,6-dimethyl-2-(trifluoromethyl)pyrimidin-4-yl]hydrazine. InChIKey: VCIGPLAPDJQMLL-UHFFFAOYSA-N.
| Molecular formula | C7H9F3N4 |
|---|---|
| Molecular weight | 206.17 g/mol |
| IUPAC name | [5,6-dimethyl-2-(trifluoromethyl)pyrimidin-4-yl]hydrazine |
| InChIKey | VCIGPLAPDJQMLL-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(N=C1NN)C(F)(F)F)C |
Computed by PubChem (NCBI)