Products 68029-52-7
CAS 68029-52-7 is the registry number for (E)-2-Cyano-3-phenylprop-2-enethioamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-2-cyano-3-phenylprop-2-enethioamide (CAS 68029-52-7) is a chemical compound with the molecular formula C10H8N2S and a molecular weight of 188.25 g/mol. IUPAC name: (E)-2-cyano-3-phenylprop-2-enethioamide. InChIKey: DFVRLZLNOKWNEH-RMKNXTFCSA-N.
| Molecular formula | C10H8N2S |
|---|---|
| Molecular weight | 188.25 g/mol |
| IUPAC name | (E)-2-cyano-3-phenylprop-2-enethioamide |
| InChIKey | DFVRLZLNOKWNEH-RMKNXTFCSA-N |
| SMILES | C1=CC=C(C=C1)/C=C(\C#N)/C(=S)N |
Computed by PubChem (NCBI)