CAS 68050-37-3 appears in our catalog under these names: 5-Chloroquinolin-2-amine, 96%, 5-Chloroquinolin-2-amine, 97%, 5-Chloroquinolin-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg.
5-chloroquinolin-2-amine (CAS 68050-37-3) is a chemical compound with the molecular formula C9H7ClN2 and a molecular weight of 178.62 g/mol. IUPAC name: 5-chloroquinolin-2-amine. InChIKey: LFNYFPRSHXRDDH-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2 |
|---|---|
| Molecular weight | 178.62 g/mol |
| IUPAC name | 5-chloroquinolin-2-amine |
| InChIKey | LFNYFPRSHXRDDH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)N)C(=C1)Cl |
Computed by PubChem (NCBI)