CAS 68052-51-7 appears in our catalog under these names: N,N-Dibutyl-n-ethylbutan-1-aminium ethyl sulfate, 95%, tributylethylammonium ethyl sulphate, tributylethylammonium ethyl sulphate, 95%, 95%, TRIBUTYLETHYLAMMONIUM ETHYL SULPHATE, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100g, 25g.
Ethyl sulfate;tributyl(ethyl)azanium (CAS 68052-51-7) is a chemical compound with the molecular formula C16H37NO4S and a molecular weight of 339.5 g/mol. IUPAC name: ethyl sulfate;tributyl(ethyl)azanium. InChIKey: GELDODMEEMXBIV-UHFFFAOYSA-M.
| Molecular formula | C16H37NO4S |
|---|---|
| Molecular weight | 339.5 g/mol |
| IUPAC name | ethyl sulfate;tributyl(ethyl)azanium |
| InChIKey | GELDODMEEMXBIV-UHFFFAOYSA-M |
| SMILES | CCCC[N+](CC)(CCCC)CCCC.CCOS(=O)(=O)[O-] |
Computed by PubChem (NCBI)