Products 680590-49-2
CAS 680590-49-2 appears in our catalog under these names: N-Ethyl-2-[(6-methoxy-3-pyridinyl)[(2-methylphenyl)sulfonyl]amino]-N-(3-pyridinylmethyl)acetamide, 99%, 99%, EMPA, EMPA/ 99.91% (existing batch purity), EMPA, 99.92%, EMPA, 98%. Offered by: Chemat, TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 50mg, 100mg, 250mg, 10mg, 1mg, 5mg, 25mg, 200mg.
N-ethyl-2-[(6-methoxy-3-pyridinyl)-(2-methylphenyl)sulfonylamino]-N-(pyridin-3-ylmethyl)acetamide (CAS 680590-49-2) is a chemical compound with the molecular formula C23H26N4O4S and a molecular weight of 454.5 g/mol. IUPAC name: N-ethyl-2-[(6-methoxy-3-pyridinyl)-(2-methylphenyl)sulfonylamino]-N-(pyridin-3-ylmethyl)acetamide. InChIKey: KJPHTXTWFHVJIG-UHFFFAOYSA-N.
| Molecular formula | C23H26N4O4S |
|---|---|
| Molecular weight | 454.5 g/mol |
| IUPAC name | N-ethyl-2-[(6-methoxy-3-pyridinyl)-(2-methylphenyl)sulfonylamino]-N-(pyridin-3-ylmethyl)acetamide |
| InChIKey | KJPHTXTWFHVJIG-UHFFFAOYSA-N |
| SMILES | CCN(CC1=CN=CC=C1)C(=O)CN(C2=CN=C(C=C2)OC)S(=O)(=O)C3=CC=CC=C3C |
Computed by PubChem (NCBI)