CAS 68101-20-2 is the registry number for 4-Oxo-4H-1-benzopyran-3-carboxaldehyde 3-(2-(4-Nitrophenyl)hydrazone). Offered by: TRC. Available pack sizes: 250mg.
3-[[(4-nitrophenyl)hydrazinylidene]methyl]chromen-4-one (CAS 68101-20-2) is a chemical compound with the molecular formula C16H11N3O4 and a molecular weight of 309.28 g/mol. IUPAC name: 3-[[(4-nitrophenyl)hydrazinylidene]methyl]chromen-4-one. InChIKey: WYRRLCAKWTYGOD-UHFFFAOYSA-N.
| Molecular formula | C16H11N3O4 |
|---|---|
| Molecular weight | 309.28 g/mol |
| IUPAC name | 3-[[(4-nitrophenyl)hydrazinylidene]methyl]chromen-4-one |
| InChIKey | WYRRLCAKWTYGOD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=CO2)C=NNC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)