CAS 681034-15-1 is the registry number for (S)-S-((2,2,5,5-Tetramethyl-1-(l1-oxidaneyl)pyrrolidin-3-yl)methyl) methanesulfonothioate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-1-hydroxy-2,2,5,5-tetramethyl-3-(methylsulfonylsulfanylmethyl)pyrrolidine (CAS 681034-15-1) is a chemical compound with the molecular formula C10H21NO3S2 and a molecular weight of 267.4 g/mol. IUPAC name: (3S)-1-hydroxy-2,2,5,5-tetramethyl-3-(methylsulfonylsulfanylmethyl)pyrrolidine. InChIKey: WRGRMWJGHAOGQV-MRVPVSSYSA-N.
| Molecular formula | C10H21NO3S2 |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | (3S)-1-hydroxy-2,2,5,5-tetramethyl-3-(methylsulfonylsulfanylmethyl)pyrrolidine |
| InChIKey | WRGRMWJGHAOGQV-MRVPVSSYSA-N |
| SMILES | CC1(C[C@@H](C(N1O)(C)C)CSS(=O)(=O)C)C |
Computed by PubChem (NCBI)