CAS 68114-23-8 is the registry number for Carbocisteine Diisopropyl Ester Hydrochloride. Offered by: Mikromol. Available pack sizes: 25mg.
Propan-2-yl (2R)-2-amino-3-(2-oxo-2-propan-2-yloxyethyl)sulfanylpropanoate;hydrochloride (CAS 68114-23-8) is a chemical compound with the molecular formula C11H22ClNO4S and a molecular weight of 299.82 g/mol. IUPAC name: propan-2-yl (2R)-2-amino-3-(2-oxo-2-propan-2-yloxyethyl)sulfanylpropanoate;hydrochloride. InChIKey: TWPCRACRGILCCO-FVGYRXGTSA-N.
| Molecular formula | C11H22ClNO4S |
|---|---|
| Molecular weight | 299.82 g/mol |
| IUPAC name | propan-2-yl (2R)-2-amino-3-(2-oxo-2-propan-2-yloxyethyl)sulfanylpropanoate;hydrochloride |
| InChIKey | TWPCRACRGILCCO-FVGYRXGTSA-N |
| SMILES | CC(C)OC(=O)CSC[C@@H](C(=O)OC(C)C)N.Cl |
Computed by PubChem (NCBI)