CAS 68123-29-5 is the registry number for Triscarbonate. Offered by: TRC. Available pack sizes: 1g.
Bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);carbonic acid (CAS 68123-29-5) is a chemical compound with the molecular formula C9H24N2O9 and a molecular weight of 304.30 g/mol. IUPAC name: bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);carbonic acid. InChIKey: GYQWVHROHDZXRS-UHFFFAOYSA-N.
| Molecular formula | C9H24N2O9 |
|---|---|
| Molecular weight | 304.30 g/mol |
| IUPAC name | bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);carbonic acid |
| InChIKey | GYQWVHROHDZXRS-UHFFFAOYSA-N |
| SMILES | C(C(CO)(CO)N)O.C(C(CO)(CO)N)O.C(=O)(O)O |
Computed by PubChem (NCBI)