Products 681240-09-5

CAS 681240-09-5 appears in our catalog under these names: 2,2-Difluoro-2-(1-hydroxycyclobutyl)acetic acid, 2,2-difluoro-2-(1-hydroxycyclobutyl)acetic acid, >95%, >95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2,2-difluoro-2-(1-hydroxycyclobutyl)acetic acid (CAS 681240-09-5) is a chemical compound with the molecular formula C6H8F2O3 and a molecular weight of 166.12 g/mol. IUPAC name: 2,2-difluoro-2-(1-hydroxycyclobutyl)acetic acid. InChIKey: OTAIIWWWPNARPR-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8F2O3
Molecular weight166.12 g/mol
IUPAC name2,2-difluoro-2-(1-hydroxycyclobutyl)acetic acid
InChIKeyOTAIIWWWPNARPR-UHFFFAOYSA-N
SMILESC1CC(C1)(C(C(=O)O)(F)F)O

Computed by PubChem (NCBI)