Products 681245-85-2
CAS 681245-85-2 appears in our catalog under these names: A–800141, A-800141. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
2-[[2-[(Z)-3-(diethylamino)prop-1-enyl]phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid (CAS 681245-85-2) is a chemical compound with the molecular formula C24H30N2O4S and a molecular weight of 442.6 g/mol. IUPAC name: 2-[[2-[(Z)-3-(diethylamino)prop-1-enyl]phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid. InChIKey: GKLFXULRKHHGON-XFXZXTDPSA-N.
| Molecular formula | C24H30N2O4S |
|---|---|
| Molecular weight | 442.6 g/mol |
| IUPAC name | 2-[[2-[(Z)-3-(diethylamino)prop-1-enyl]phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
| InChIKey | GKLFXULRKHHGON-XFXZXTDPSA-N |
| SMILES | CCN(CC)C/C=C\C1=CC=CC=C1S(=O)(=O)NC2=C(C3=C(CCCC3)C=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
orb2945107, Anthranilic Acid Sulfonamide, 24a