CAS 681281-88-9 appears in our catalog under these names: Akt Inhibitor IV, AKT inhibitor IV, 95+%, Akt Inhibitor IV, Akt Inhibitor IV 1PC X 1MG, Akt Inhibitor IV 1PC X 5MG. Offered by: TRC, AmBeed, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 1g, 1mg, 10mg, 25mg, 5mg, 1 mg.
N-[(E)-2-[5-(1,3-benzothiazol-2-yl)-3-ethyl-1-phenylbenzimidazol-3-ium-2-yl]ethenyl]-N-methylaniline iodide (CAS 681281-88-9) is a chemical compound with the molecular formula C31H27IN4S and a molecular weight of 614.5 g/mol. IUPAC name: N-[(E)-2-[5-(1,3-benzothiazol-2-yl)-3-ethyl-1-phenylbenzimidazol-3-ium-2-yl]ethenyl]-N-methylaniline iodide. InChIKey: NAYRELMNTQSBIN-UHFFFAOYSA-M.
| Molecular formula | C31H27IN4S |
|---|---|
| Molecular weight | 614.5 g/mol |
| IUPAC name | N-[(E)-2-[5-(1,3-benzothiazol-2-yl)-3-ethyl-1-phenylbenzimidazol-3-ium-2-yl]ethenyl]-N-methylaniline iodide |
| InChIKey | NAYRELMNTQSBIN-UHFFFAOYSA-M |
| SMILES | CC[N+]1=C(N(C2=C1C=C(C=C2)C3=NC4=CC=CC=C4S3)C5=CC=CC=C5)/C=C/N(C)C6=CC=CC=C6.[I-] |
Computed by PubChem (NCBI)