Products 681282-72-4
CAS 681282-72-4 appears in our catalog under these names: Saxagliptin Impurity 23, Saxagliptin Impurity 6, Saxagliptin Impurity 25. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S)-2-[(3R,5S)-3,5-dihydroxy-1-adamantyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 681282-72-4) is a chemical compound with the molecular formula C17H27NO6 and a molecular weight of 341.4 g/mol. IUPAC name: (2S)-2-[(3R,5S)-3,5-dihydroxy-1-adamantyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: ZNYYESJIBYSDAL-HBMIPKKFSA-N.
| Molecular formula | C17H27NO6 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | (2S)-2-[(3R,5S)-3,5-dihydroxy-1-adamantyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | ZNYYESJIBYSDAL-HBMIPKKFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)O)C12CC3C[C@](C1)(C[C@@](C3)(C2)O)O |
Computed by PubChem (NCBI)
Synonyms:
Saxagliptin Impurity 19