CAS 681470-19-9 is the registry number for 1-(3-(Trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]ethanone (CAS 681470-19-9) is a chemical compound with the molecular formula C6H3F3N4OS and a molecular weight of 236.18 g/mol. IUPAC name: 1-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]ethanone. InChIKey: UUQVKVAGSIACSN-UHFFFAOYSA-N.
| Molecular formula | C6H3F3N4OS |
|---|---|
| Molecular weight | 236.18 g/mol |
| IUPAC name | 1-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]ethanone |
| InChIKey | UUQVKVAGSIACSN-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=NN2C(=NN=C2S1)C(F)(F)F |
Computed by PubChem (NCBI)