Products 681482-80-4

CAS 681482-80-4 is the registry number for Delamanid Impurity 8. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-[4-(oxan-2-yloxy)phenyl]-4-[4-(trifluoromethoxy)phenoxy]piperidine (CAS 681482-80-4) is a chemical compound with the molecular formula C23H26F3NO4 and a molecular weight of 437.5 g/mol. IUPAC name: 1-[4-(oxan-2-yloxy)phenyl]-4-[4-(trifluoromethoxy)phenoxy]piperidine. InChIKey: IDJPHWLCQFLSJT-UHFFFAOYSA-N.

Identity
Molecular formulaC23H26F3NO4
Molecular weight437.5 g/mol
IUPAC name1-[4-(oxan-2-yloxy)phenyl]-4-[4-(trifluoromethoxy)phenoxy]piperidine
InChIKeyIDJPHWLCQFLSJT-UHFFFAOYSA-N
SMILESC1CCOC(C1)OC2=CC=C(C=C2)N3CCC(CC3)OC4=CC=C(C=C4)OC(F)(F)F

Computed by PubChem (NCBI)