Products 681490-91-5

CAS 681490-91-5 is the registry number for Delamanid Impurity 1. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

(2R)-3-(2-chloro-4-nitroimidazol-1-yl)-2-methylpropane-1,2-diol (CAS 681490-91-5) is a chemical compound with the molecular formula C7H10ClN3O4 and a molecular weight of 235.62 g/mol. IUPAC name: (2R)-3-(2-chloro-4-nitroimidazol-1-yl)-2-methylpropane-1,2-diol. InChIKey: UEYAJHCNNXRAIQ-SSDOTTSWSA-N.

Identity
Molecular formulaC7H10ClN3O4
Molecular weight235.62 g/mol
IUPAC name(2R)-3-(2-chloro-4-nitroimidazol-1-yl)-2-methylpropane-1,2-diol
InChIKeyUEYAJHCNNXRAIQ-SSDOTTSWSA-N
SMILESC[C@@](CN1C=C(N=C1Cl)[N+](=O)[O-])(CO)O

Computed by PubChem (NCBI)