Products 68171-98-2
CAS 68171-98-2 appears in our catalog under these names: H–Gly–Gly–Glu–Ala–OH, H-Gly-Gly-Glu-Ala-OH. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 500mg, 1000mg.
(4S)-4-[[2-[(2-aminoacetyl)amino]acetyl]amino]-5-[[(1S)-1-carboxyethyl]amino]-5-oxopentanoic acid (CAS 68171-98-2) is a chemical compound with the molecular formula C12H20N4O7 and a molecular weight of 332.31 g/mol. IUPAC name: (4S)-4-[[2-[(2-aminoacetyl)amino]acetyl]amino]-5-[[(1S)-1-carboxyethyl]amino]-5-oxopentanoic acid. InChIKey: VOPRYFJERIZYDK-BQBZGAKWSA-N.
| Molecular formula | C12H20N4O7 |
|---|---|
| Molecular weight | 332.31 g/mol |
| IUPAC name | (4S)-4-[[2-[(2-aminoacetyl)amino]acetyl]amino]-5-[[(1S)-1-carboxyethyl]amino]-5-oxopentanoic acid |
| InChIKey | VOPRYFJERIZYDK-BQBZGAKWSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)CNC(=O)CN |
Computed by PubChem (NCBI)