CAS 681838-84-6 is the registry number for Acemetacin Methyl Ester. Offered by: Mikromol. Available pack sizes: 25mg.
(2-methoxy-2-oxoethyl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate (CAS 681838-84-6) is a chemical compound with the molecular formula C22H20ClNO6 and a molecular weight of 429.8 g/mol. IUPAC name: (2-methoxy-2-oxoethyl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate. InChIKey: WHTHSWYUFZICQE-UHFFFAOYSA-N.
| Molecular formula | C22H20ClNO6 |
|---|---|
| Molecular weight | 429.8 g/mol |
| IUPAC name | (2-methoxy-2-oxoethyl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
| InChIKey | WHTHSWYUFZICQE-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)OCC(=O)OC |
Computed by PubChem (NCBI)