CAS 681845-09-0 is the registry number for N-(3,4-dichlorophenyl)-1-phenylcyclopentane-1-carboxamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(3,4-dichlorophenyl)-1-phenylcyclopentane-1-carboxamide (CAS 681845-09-0) is a chemical compound with the molecular formula C18H17Cl2NO and a molecular weight of 334.2 g/mol. IUPAC name: N-(3,4-dichlorophenyl)-1-phenylcyclopentane-1-carboxamide. InChIKey: NEEMUZPSMJZFPW-UHFFFAOYSA-N.
| Molecular formula | C18H17Cl2NO |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | N-(3,4-dichlorophenyl)-1-phenylcyclopentane-1-carboxamide |
| InChIKey | NEEMUZPSMJZFPW-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2)C(=O)NC3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)