CAS 6819-07-4 appears in our catalog under these names: 4-Nitrophenyl β-D-xylobioside, 5 mg, 4-Nitrophenyl β-D-xylobioside, 10 mg, 4-Nitrophenyl β-D-xylobioside, 25 mg. Offered by: Roth. Available pack sizes: 5mg, 10mg, 25mg.
(2S,3R,4S,5R)-2-[(3R,4R,5R,6S)-4,5-dihydroxy-6-(4-nitrophenoxy)oxan-3-yl]oxyoxane-3,4,5-triol (CAS 6819-07-4) is a chemical compound with the molecular formula C16H21NO11 and a molecular weight of 403.34 g/mol. IUPAC name: (2S,3R,4S,5R)-2-[(3R,4R,5R,6S)-4,5-dihydroxy-6-(4-nitrophenoxy)oxan-3-yl]oxyoxane-3,4,5-triol. InChIKey: LPCFVCUKBNKNBF-DDJMUGOQSA-N.
| Molecular formula | C16H21NO11 |
|---|---|
| Molecular weight | 403.34 g/mol |
| IUPAC name | (2S,3R,4S,5R)-2-[(3R,4R,5R,6S)-4,5-dihydroxy-6-(4-nitrophenoxy)oxan-3-yl]oxyoxane-3,4,5-triol |
| InChIKey | LPCFVCUKBNKNBF-DDJMUGOQSA-N |
| SMILES | C1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2CO[C@H]([C@@H]([C@H]2O)O)OC3=CC=C(C=C3)[N+](=O)[O-])O)O)O |
Computed by PubChem (NCBI)