Products 68192-15-4
CAS 68192-15-4 appears in our catalog under these names: Prostaglandin F2α dimethyl amide, Prostaglandin F2α dimethyl amide. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 1 mg, 5 mg.
(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]cyclopentyl]-N,N-dimethylhept-5-enamide (CAS 68192-15-4) is a chemical compound with the molecular formula C22H39NO4 and a molecular weight of 381.5 g/mol. IUPAC name: (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]cyclopentyl]-N,N-dimethylhept-5-enamide. InChIKey: QGAWKBHDDFBNMX-HRUISTIBSA-N.
| Molecular formula | C22H39NO4 |
|---|---|
| Molecular weight | 381.5 g/mol |
| IUPAC name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]cyclopentyl]-N,N-dimethylhept-5-enamide |
| InChIKey | QGAWKBHDDFBNMX-HRUISTIBSA-N |
| SMILES | CCCCC[C@H](/C=C/[C@H]1[C@@H](C[C@@H]([C@@H]1C/C=C\CCCC(=O)N(C)C)O)O)O |
Computed by PubChem (NCBI)