CAS 68194-09-2 is the registry number for PCB 152, Concentration: 100 µg/ml Solvent: Isooctane. Offered by: HPC Standards. Available pack sizes: 1x5ml.
1,2,4,5-tetrachloro-3-(2,6-dichlorophenyl)benzene (CAS 68194-09-2) is a chemical compound with the molecular formula C12H4Cl6 and a molecular weight of 360.9 g/mol. IUPAC name: 1,2,4,5-tetrachloro-3-(2,6-dichlorophenyl)benzene. InChIKey: CLODVDBWNVQLGO-UHFFFAOYSA-N.
| Molecular formula | C12H4Cl6 |
|---|---|
| Molecular weight | 360.9 g/mol |
| IUPAC name | 1,2,4,5-tetrachloro-3-(2,6-dichlorophenyl)benzene |
| InChIKey | CLODVDBWNVQLGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C2=C(C(=CC(=C2Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)