CAS 6820-54-8 appears in our catalog under these names: Phenolphthalein Glucuronide, Sodium Salt, >95% (HPLC), PHENOLPHTHALEIN GLUCURONIC ACID SODIUM SALT, Phenophthalein glucuronide sodium salt, Phenolphthalein b-D-glucuronide sodium salt monohydrate, Phenolphthalein b-D-glucuronic acid sodium salt. Offered by: TRC, GLPBio, Chemat, Biosynth, Roth. Available pack sizes: 250mg, 25mg, 100mg, 1g, 500mg, 50mg, 100 mg, 50 mg.
Sodium (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-[1-(4-hydroxyphenyl)-3-oxo-2-benzofuran-1-yl]phenoxy]oxane-2-carboxylate (CAS 6820-54-8) is a chemical compound with the molecular formula C26H21NaO10 and a molecular weight of 516.4 g/mol. IUPAC name: sodium (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-[1-(4-hydroxyphenyl)-3-oxo-2-benzofuran-1-yl]phenoxy]oxane-2-carboxylate. InChIKey: GBLJULUMBNYFAK-PDFLYTMFSA-M.
| Molecular formula | C26H21NaO10 |
|---|---|
| Molecular weight | 516.4 g/mol |
| IUPAC name | sodium (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-[1-(4-hydroxyphenyl)-3-oxo-2-benzofuran-1-yl]phenoxy]oxane-2-carboxylate |
| InChIKey | GBLJULUMBNYFAK-PDFLYTMFSA-M |
| SMILES | C1=CC=C2C(=C1)C(=O)OC2(C3=CC=C(C=C3)O)C4=CC=C(C=C4)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)C(=O)[O-])O)O)O.[Na+] |
Computed by PubChem (NCBI)