CAS 68207-15-8 is the registry number for EBOV-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
N'-[2-(5-chloro-2-nitrophenyl)sulfanylphenyl]-2-(diethylamino)acetohydrazide (CAS 68207-15-8) is a chemical compound with the molecular formula C18H21ClN4O3S and a molecular weight of 408.9 g/mol. IUPAC name: N'-[2-(5-chloro-2-nitrophenyl)sulfanylphenyl]-2-(diethylamino)acetohydrazide. InChIKey: MRCJNFVLBGGKEJ-UHFFFAOYSA-N.
| Molecular formula | C18H21ClN4O3S |
|---|---|
| Molecular weight | 408.9 g/mol |
| IUPAC name | N'-[2-(5-chloro-2-nitrophenyl)sulfanylphenyl]-2-(diethylamino)acetohydrazide |
| InChIKey | MRCJNFVLBGGKEJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(=O)NNC1=CC=CC=C1SC2=C(C=CC(=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)