CAS 68207-16-9 is the registry number for EBOV-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
N'-[2-(5-chloro-2-nitrophenyl)sulfanylphenyl]-2-pyrrolidin-1-ylacetohydrazide (CAS 68207-16-9) is a chemical compound with the molecular formula C18H19ClN4O3S and a molecular weight of 406.9 g/mol. IUPAC name: N'-[2-(5-chloro-2-nitrophenyl)sulfanylphenyl]-2-pyrrolidin-1-ylacetohydrazide. InChIKey: SWAOBCQKKPYMOI-UHFFFAOYSA-N.
| Molecular formula | C18H19ClN4O3S |
|---|---|
| Molecular weight | 406.9 g/mol |
| IUPAC name | N'-[2-(5-chloro-2-nitrophenyl)sulfanylphenyl]-2-pyrrolidin-1-ylacetohydrazide |
| InChIKey | SWAOBCQKKPYMOI-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC(=O)NNC2=CC=CC=C2SC3=C(C=CC(=C3)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)