Products 68227-33-8

CAS 68227-33-8 is the registry number for 2,5,8,11-Tetramethyl-6-dodecyne-5,8-diol. Offered by: TRC, Biosynth. Available pack sizes: 1g, 250mg, 500mg, 10g, 5g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

2,5,8,11-tetramethyldodec-6-yne-5,8-diol (CAS 68227-33-8) is a chemical compound with the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. IUPAC name: 2,5,8,11-tetramethyldodec-6-yne-5,8-diol. InChIKey: RHRRUYIZUBAQTQ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H30O2
Molecular weight254.41 g/mol
IUPAC name2,5,8,11-tetramethyldodec-6-yne-5,8-diol
InChIKeyRHRRUYIZUBAQTQ-UHFFFAOYSA-N
SMILESCC(C)CCC(C)(C#CC(C)(CCC(C)C)O)O

Computed by PubChem (NCBI)