Products 68234-47-9
CAS 68234-47-9 appears in our catalog under these names: o-Phthalaldehyde-d6, >95% (HPLC), Phthalaldehyde-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1 mg, 10 mg, 5 mg.
Deuterio-(2,3,4,5-tetradeuterio-6-deuteriocarbonylphenyl)methanone (CAS 68234-47-9) is a chemical compound with the molecular formula C8H6O2 and a molecular weight of 140.17 g/mol. IUPAC name: deuterio-(2,3,4,5-tetradeuterio-6-deuteriocarbonylphenyl)methanone. InChIKey: ZWLUXSQADUDCSB-MZWXYZOWSA-N.
| Molecular formula | C8H6O2 |
|---|---|
| Molecular weight | 140.17 g/mol |
| IUPAC name | deuterio-(2,3,4,5-tetradeuterio-6-deuteriocarbonylphenyl)methanone |
| InChIKey | ZWLUXSQADUDCSB-MZWXYZOWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)[2H])C(=O)[2H])[2H])[2H] |
Computed by PubChem (NCBI)