CAS 68234-48-0 is the registry number for 6,13-Pentacenedione-d12. Offered by: TRC. Available pack sizes: 10mg, 1mg.
1,2,3,4,5,7,8,9,10,11,12,14-dodecadeuteriopentacene-6,13-dione (CAS 68234-48-0) is a chemical compound with the molecular formula C22H12O2 and a molecular weight of 320.4 g/mol. IUPAC name: 1,2,3,4,5,7,8,9,10,11,12,14-dodecadeuteriopentacene-6,13-dione. InChIKey: UFCVADNIXDUEFZ-AQZSQYOVSA-N.
| Molecular formula | C22H12O2 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 1,2,3,4,5,7,8,9,10,11,12,14-dodecadeuteriopentacene-6,13-dione |
| InChIKey | UFCVADNIXDUEFZ-AQZSQYOVSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C3C(=C(C2=C1[2H])[2H])C(=O)C4=C(C5=C(C(=C(C(=C5C(=C4C3=O)[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)