CAS 682745-40-0 appears in our catalog under these names: Tivozanib (hydrate), Tivozanib (hydrate), 99.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 1 mg.
1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea;hydrate (CAS 682745-40-0) is a chemical compound with the molecular formula C22H21ClN4O6 and a molecular weight of 472.9 g/mol. IUPAC name: 1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea;hydrate. InChIKey: VTWZGSZTIGEYIC-UHFFFAOYSA-N.
| Molecular formula | C22H21ClN4O6 |
|---|---|
| Molecular weight | 472.9 g/mol |
| IUPAC name | 1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea;hydrate |
| InChIKey | VTWZGSZTIGEYIC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)NC(=O)NC2=C(C=C(C=C2)OC3=C4C=C(C(=CC4=NC=C3)OC)OC)Cl.O |
Computed by PubChem (NCBI)