CAS 682787-78-6 is the registry number for N-(2,3-Dichlorophenyl)-2-methyl-5-nitrobenzenesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2,3-dichlorophenyl)-2-methyl-5-nitrobenzenesulfonamide (CAS 682787-78-6) is a chemical compound with the molecular formula C13H10Cl2N2O4S and a molecular weight of 361.2 g/mol. IUPAC name: N-(2,3-dichlorophenyl)-2-methyl-5-nitrobenzenesulfonamide. InChIKey: NCTBLBODUKNGAM-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2N2O4S |
|---|---|
| Molecular weight | 361.2 g/mol |
| IUPAC name | N-(2,3-dichlorophenyl)-2-methyl-5-nitrobenzenesulfonamide |
| InChIKey | NCTBLBODUKNGAM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)NC2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)