CAS 683228-06-0 is the registry number for 4-Carboxy-1-octylpyridinium Iodide. Offered by: TRC. Available pack sizes: 750mg.
1-octylpyridin-1-ium-4-carboxylic acid iodide (CAS 683228-06-0) is a chemical compound with the molecular formula C14H22INO2 and a molecular weight of 363.23 g/mol. IUPAC name: 1-octylpyridin-1-ium-4-carboxylic acid iodide. InChIKey: HFLLBGMFJCIJFN-UHFFFAOYSA-N.
| Molecular formula | C14H22INO2 |
|---|---|
| Molecular weight | 363.23 g/mol |
| IUPAC name | 1-octylpyridin-1-ium-4-carboxylic acid iodide |
| InChIKey | HFLLBGMFJCIJFN-UHFFFAOYSA-N |
| SMILES | CCCCCCCC[N+]1=CC=C(C=C1)C(=O)O.[I-] |
Computed by PubChem (NCBI)