Products 683228-06-0

CAS 683228-06-0 is the registry number for 4-Carboxy-1-octylpyridinium Iodide. Offered by: TRC. Available pack sizes: 750mg.

Structural formula: {0} (CAS {1})

1-octylpyridin-1-ium-4-carboxylic acid iodide (CAS 683228-06-0) is a chemical compound with the molecular formula C14H22INO2 and a molecular weight of 363.23 g/mol. IUPAC name: 1-octylpyridin-1-ium-4-carboxylic acid iodide. InChIKey: HFLLBGMFJCIJFN-UHFFFAOYSA-N.

Identity
Molecular formulaC14H22INO2
Molecular weight363.23 g/mol
IUPAC name1-octylpyridin-1-ium-4-carboxylic acid iodide
InChIKeyHFLLBGMFJCIJFN-UHFFFAOYSA-N
SMILESCCCCCCCC[N+]1=CC=C(C=C1)C(=O)O.[I-]

Computed by PubChem (NCBI)