CAS 683240-52-0 is the registry number for 4-Bromo-6-(trifluoromethyl)-1,3-dihydro-1,3-benzodiazol-2-one, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-bromo-6-(trifluoromethyl)-1,3-dihydrobenzimidazol-2-one (CAS 683240-52-0) is a chemical compound with the molecular formula C8H4BrF3N2O and a molecular weight of 281.03 g/mol. IUPAC name: 4-bromo-6-(trifluoromethyl)-1,3-dihydrobenzimidazol-2-one. InChIKey: MWJMZNFWRMPROD-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3N2O |
|---|---|
| Molecular weight | 281.03 g/mol |
| IUPAC name | 4-bromo-6-(trifluoromethyl)-1,3-dihydrobenzimidazol-2-one |
| InChIKey | MWJMZNFWRMPROD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=O)N2)Br)C(F)(F)F |
Computed by PubChem (NCBI)