CAS 68327-00-4 is the registry number for rel-(1R,2R)-2-[(Phenylmethyl)amino]cyclopentanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
Trans-(1R,2R)-2-(benzylamino)cyclopentan-1-ol (CAS 68327-00-4) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. IUPAC name: trans-(1R,2R)-2-(benzylamino)cyclopentan-1-ol. InChIKey: FEGVMDAESGIXLU-VXGBXAGGSA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | trans-(1R,2R)-2-(benzylamino)cyclopentan-1-ol |
| InChIKey | FEGVMDAESGIXLU-VXGBXAGGSA-N |
| SMILES | C1C[C@H]([C@@H](C1)O)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)