CAS 683274-57-9 is the registry number for 3-(5-Bromothiophen-2-yl)-1-methyl-5-(trifluoromethyl)-1H-pyrazole. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
3-(5-bromothiophen-2-yl)-1-methyl-5-(trifluoromethyl)pyrazole (CAS 683274-57-9) is a chemical compound with the molecular formula C9H6BrF3N2S and a molecular weight of 311.12 g/mol. IUPAC name: 3-(5-bromothiophen-2-yl)-1-methyl-5-(trifluoromethyl)pyrazole. InChIKey: CWMFRUPCHXXCOD-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3N2S |
|---|---|
| Molecular weight | 311.12 g/mol |
| IUPAC name | 3-(5-bromothiophen-2-yl)-1-methyl-5-(trifluoromethyl)pyrazole |
| InChIKey | CWMFRUPCHXXCOD-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C2=CC=C(S2)Br)C(F)(F)F |
Computed by PubChem (NCBI)