CAS 683274-75-1 is the registry number for 2-Bromo-1-(5-chloro-2-methoxy-4-methyl-3-nitro phenyl)ethanone, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
2-bromo-1-(5-chloro-2-methoxy-4-methyl-3-nitrophenyl)ethanone (CAS 683274-75-1) is a chemical compound with the molecular formula C10H9BrClNO4 and a molecular weight of 322.54 g/mol. IUPAC name: 2-bromo-1-(5-chloro-2-methoxy-4-methyl-3-nitrophenyl)ethanone. InChIKey: MRJQMHKVHNQGJR-UHFFFAOYSA-N.
| Molecular formula | C10H9BrClNO4 |
|---|---|
| Molecular weight | 322.54 g/mol |
| IUPAC name | 2-bromo-1-(5-chloro-2-methoxy-4-methyl-3-nitrophenyl)ethanone |
| InChIKey | MRJQMHKVHNQGJR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1[N+](=O)[O-])OC)C(=O)CBr)Cl |
Computed by PubChem (NCBI)